missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Cytochrome C From Horse Heart MP Biomedicals
Supplier: MP Biomedicals Inc 021014675
Specifications
| Cytochrome C | |
| 9007-43-6 | |
| MFCD00130890 | |
| cytochrome c, 3-7,12-bis 1-2-amino-3-methylamino-3-oxopropyl sulfanylethyl-18-2-carboxyethyl-3,8,13,17-tetramethylporphyrin-21,23-diid-2-yl propanoic acid; iron 2+ | |
| CC(SC(=O)[C@@H](N)CS)C1=C(C)\C2=C\C3=C(C(C)SC(=O)[C@@H](N)CS)C(C)=C4CC5N=C(\C=C6/N([Fe++]N34)\C(=C/C1=N2)C(C)=C6CCC(O)=O)C(CCC(O)=O)=C5C | |
| 892.94 | |
| 12000 |
| From Horse Heart | |
| C40H48FeN6O6S4 | |
| 500 mg | |
| UMUOLVQYJUIZKD-RHANTFMNSA-L | |
| 3-[8,13-bis[1-[2-amino-3-(methylamino)-3-oxopropyl]sulfanylethyl]-18-(2-carboxyethyl)-3,7,12,17-tetramethylporphyrin-21,24-diid-2-yl]propanoic acid;iron(2+) | |
| 16057918 |
Chemical Identifiers
| 9007-43-6 | |
| 892.94 | |
| UMUOLVQYJUIZKD-RHANTFMNSA-L | |
| 16057918 | |
| CC(SC(=O)[C@@H](N)CS)C1=C(C)\C2=C\C3=C(C(C)SC(=O)[C@@H](N)CS)C(C)=C4CC5N=C(\C=C6/N([Fe++]N34)\C(=C/C1=N2)C(C)=C6CCC(O)=O)C(CCC(O)=O)=C5C |
| C40H48FeN6O6S4 | |
| MFCD00130890 | |
| cytochrome c, 3-7,12-bis 1-2-amino-3-methylamino-3-oxopropyl sulfanylethyl-18-2-carboxyethyl-3,8,13,17-tetramethylporphyrin-21,23-diid-2-yl propanoic acid; iron 2+ | |
| 3-[8,13-bis[1-[2-amino-3-(methylamino)-3-oxopropyl]sulfanylethyl]-18-(2-carboxyethyl)-3,7,12,17-tetramethylporphyrin-21,24-diid-2-yl]propanoic acid;iron(2+) |