missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
DL-alpha-Tocopherol 96.0+%, TCI America™
Supplier: TCI America T025125G
Specifications
| DL-alpha-Tocopherol | |
| 4°C | |
| 220°C | |
| MFCD00072051 | |
| vitamin e, alpha-tocopherol, d-alpha-tocopherol, 5,7,8-trimethyltocol, +-alpha-tocopherol, r,r,r-alpha-tocopherol, phytogermine, eprolin, 2r,4'r,8'r-alpha-tocopherol, dl-a-tocopherol | |
| CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC[C@]1(C)CCC2=C(C)C(O)=C(C)C(C)=C2O1 | |
| 430.72 | |
| CHEBI:18145 | |
| ≥96.0% (GC) |
| 10191-41-0 | |
| Brown-Yellow | |
| C29H50O2 | |
| 25 g | |
| GVJHHUAWPYXKBD-IEOSBIPESA-N | |
| (2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydro-2H-1-benzopyran-6-ol | |
| 14985 | |
| 430.72 | |
| Liquid |
Chemical Identifiers
| 10191-41-0 | |
| 430.72 | |
| GVJHHUAWPYXKBD-IEOSBIPESA-N | |
| 14985 | |
| (2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydro-2H-1-benzopyran-6-ol |
| C29H50O2 | |
| MFCD00072051 | |
| vitamin e, alpha-tocopherol, d-alpha-tocopherol, 5,7,8-trimethyltocol, +-alpha-tocopherol, r,r,r-alpha-tocopherol, phytogermine, eprolin, 2r,4'r,8'r-alpha-tocopherol, dl-a-tocopherol | |
| CHEBI:18145 | |
| CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC[C@]1(C)CCC2=C(C)C(O)=C(C)C(C)=C2O1 |
Safety and Handling
EINECSNumber : (9)-0864
RTECSNumber : GA8746000
TSCA : Yes