missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Ethyl 2,4-dioxo-4-(2-thienyl)butanoate, 90%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals SPB04027EA
Specifications
| Ethyl 2, 4-dioxo-4-(2-thienyl)butanoate | |
| 90.0 | |
| Amber Glass Bottle | |
| MFCD00126316 | |
| ethyl 2,4-dioxo-4-thiophen-2-yl butanoate, ethyl 2,4-dioxo-4-2-thienyl butanoate, 2,4-dioxo-4-thiophen-2-yl-butyric acid ethyl ester, 2-thiophenebutanoicacid, a,g-dioxo-, ethyl ester, 2,4-dioxo-4-2-thienyl butanoic acid ethyl ester, 2,4-dioxo-4-thiophen-2-ylbutyric acid ethyl ester | |
| CCOC(=O)C(=O)CC(=O)C1=CC=CS1 | |
| 226.246 | |
| 226.25 |
| 36983-36-5 | |
| 90% | |
| C10H10O4S | |
| 10 g | |
| GCCFYXYKJZUHMI-UHFFFAOYSA-N | |
| ethyl 2,4-dioxo-4-thiophen-2-ylbutanoate | |
| 2799459 | |
| 90% |
Chemical Identifiers
| 36983-36-5 | |
| 226.246 | |
| GCCFYXYKJZUHMI-UHFFFAOYSA-N | |
| 2799459 | |
| CCOC(=O)C(=O)CC(=O)C1=CC=CS1 |
| C10H10O4S | |
| MFCD00126316 | |
| ethyl 2,4-dioxo-4-thiophen-2-yl butanoate, ethyl 2,4-dioxo-4-2-thienyl butanoate, 2,4-dioxo-4-thiophen-2-yl-butyric acid ethyl ester, 2-thiophenebutanoicacid, a,g-dioxo-, ethyl ester, 2,4-dioxo-4-2-thienyl butanoic acid ethyl ester, 2,4-dioxo-4-thiophen-2-ylbutyric acid ethyl ester | |
| ethyl 2,4-dioxo-4-thiophen-2-ylbutanoate |