missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Ethyltriphenylphosphonium Iodide 98.0+%, TCI America™
$116.84 - $548.13
Chemical Identifiers
| CAS | 4736-60-1 |
|---|---|
| Molecular Formula | C20H20IP |
| Molecular Weight (g/mol) | 418.26 |
| MDL Number | MFCD00040352 |
| InChI Key | SLAFUPJSGFVWPP-UHFFFAOYSA-M |
| Synonym | ethyltriphenylphosphonium iodide, phosphonium, ethyltriphenyl-, iodide, ethyl triphenylphosphonium iodide, phenylphosphonium ethyl iodide, unii-xxz2v239jn, xxz2v239jn, ethyltriphenylphosphanium iodide, phosphonium, ethyltriphenyl-, iodide 1:1, ethyl triphenyl phosphanium iodide, ethyl triphenyl phosphonium iodide |
| PubChem CID | 78474 |
| IUPAC Name | ethyltriphenylphosphanium iodide |
| SMILES | [I-].CC[P+](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
Chemical Identifiers
| 4736-60-1 | |
| 418.26 | |
| SLAFUPJSGFVWPP-UHFFFAOYSA-M | |
| 78474 | |
| [I-].CC[P+](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| C20H20IP | |
| MFCD00040352 | |
| ethyltriphenylphosphonium iodide, phosphonium, ethyltriphenyl-, iodide, ethyl triphenylphosphonium iodide, phenylphosphonium ethyl iodide, unii-xxz2v239jn, xxz2v239jn, ethyltriphenylphosphanium iodide, phosphonium, ethyltriphenyl-, iodide 1:1, ethyl triphenyl phosphanium iodide, ethyl triphenyl phosphonium iodide | |
| ethyltriphenylphosphanium iodide |
Specifications
| 4736-60-1 | |
| White | |
| MFCD00040352 | |
| 3464 | |
| SLAFUPJSGFVWPP-UHFFFAOYSA-M | |
| ethyltriphenylphosphanium iodide | |
| 78474 | |
| ≥98.0% (HPLC,T) | |
| Ethyltriphenylphosphonium Iodide |
| 170°C | |
| C20H20IP | |
| 25 g | |
| ethyltriphenylphosphonium iodide, phosphonium, ethyltriphenyl-, iodide, ethyl triphenylphosphonium iodide, phenylphosphonium ethyl iodide, unii-xxz2v239jn, xxz2v239jn, ethyltriphenylphosphanium iodide, phosphonium, ethyltriphenyl-, iodide 1:1, ethyl triphenyl phosphanium iodide, ethyl triphenyl phosphonium iodide | |
| [I-].CC[P+](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 | |
| 418.26 | |
| 418.26 | |
| Crystalline Powder |
Safety and Handling
RTECSNumber : TA2312000
TSCA : Yes