missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Guanosine-5'-triphosphate, disodium, 98.1%, MP Biomedicals™
Supplier: MP Biomedicals Inc 0210071091
Specifications
| Guanosine-5'-triphosphate, disodium | |
| White | |
| C10H14N5Na2O14P3 | |
| 1 g | |
| FIZIYLKEXVIRHJ-KHRSEZDTNA-L | |
| disodium phosphono ({[(2R,3S,4R,5R)-5-(2-amino-6-oxo-6,9-dihydro-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphonato}oxy)phosphonate | |
| 131676145 | |
| Crystalline Powder |
| 56001-37-7 | |
| 0.981 | |
| MFCD03410297 | |
| guanosine 5'-triphosphate, guanosine-5'-triphosphate disodium salt dihydrate gtp, guanosine-triphosphate, guanosine 5'-triphosphate 4-, gtp 4-, 2r,3s,4r,5r-5-2-amino-6-hydroxy-9h-purin-9-yl-3,4-dihydroxyoxolan-2-yl methyl phosphonato oxy phosphonatooxy phosphinate, 2r,3s,4r,5r-5-2-amino-6-oxo-3h-purin-9-yl-3,4-dihydroxyoxolan-2-yl methoxy-oxidophosphoryl oxy-oxidophosphoryl phosphate | |
| [Na+].[Na+].NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP([O-])(=O)OP([O-])(=O)OP(O)(O)=O)[C@@H](O)[C@H]2O)C(=O)N1 | |
| 567.14 | |
| 567.2 |
Chemical Identifiers
| 56001-37-7 | |
| 567.14 | |
| FIZIYLKEXVIRHJ-KHRSEZDTNA-L | |
| 131676145 | |
| [Na+].[Na+].NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP([O-])(=O)OP([O-])(=O)OP(O)(O)=O)[C@@H](O)[C@H]2O)C(=O)N1 |
| C10H14N5Na2O14P3 | |
| MFCD03410297 | |
| guanosine 5'-triphosphate, guanosine-5'-triphosphate disodium salt dihydrate gtp, guanosine-triphosphate, guanosine 5'-triphosphate 4-, gtp 4-, 2r,3s,4r,5r-5-2-amino-6-hydroxy-9h-purin-9-yl-3,4-dihydroxyoxolan-2-yl methyl phosphonato oxy phosphonatooxy phosphinate, 2r,3s,4r,5r-5-2-amino-6-oxo-3h-purin-9-yl-3,4-dihydroxyoxolan-2-yl methoxy-oxidophosphoryl oxy-oxidophosphoryl phosphate | |
| disodium phosphono ({[(2R,3S,4R,5R)-5-(2-amino-6-oxo-6,9-dihydro-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphonato}oxy)phosphonate |