missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Guanosine-5'-triphosphate, disodium, 98.1%, MP Biomedicals™
$1097.75 - $1097.75
Chemical Identifiers
| CAS | 56001-37-7 |
|---|---|
| Molecular Formula | C10H14N5Na2O14P3 |
| Molecular Weight (g/mol) | 567.14 |
| MDL Number | MFCD03410297 |
| InChI Key | FIZIYLKEXVIRHJ-KHRSEZDTNA-L |
| Synonym | guanosine 5'-triphosphate, guanosine-5'-triphosphate disodium salt dihydrate gtp, guanosine-triphosphate, guanosine 5'-triphosphate 4-, gtp 4-, 2r,3s,4r,5r-5-2-amino-6-hydroxy-9h-purin-9-yl-3,4-dihydroxyoxolan-2-yl methyl phosphonato oxy phosphonatooxy phosphinate, 2r,3s,4r,5r-5-2-amino-6-oxo-3h-purin-9-yl-3,4-dihydroxyoxolan-2-yl methoxy-oxidophosphoryl oxy-oxidophosphoryl phosphate |
| PubChem CID | 131676145 |
| IUPAC Name | disodium phosphono ({[(2R,3S,4R,5R)-5-(2-amino-6-oxo-6,9-dihydro-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphonato}oxy)phosphonate |
| SMILES | [Na+].[Na+].NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP([O-])(=O)OP([O-])(=O)OP(O)(O)=O)[C@@H](O)[C@H]2O)C(=O)N1 |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
ICN10071091
|
MP Biomedicals Inc
0210071091 |
1 g |
Each for $1,097.75
|
|
|||||
Chemical Identifiers
| 56001-37-7 | |
| 567.14 | |
| FIZIYLKEXVIRHJ-KHRSEZDTNA-L | |
| 131676145 | |
| [Na+].[Na+].NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP([O-])(=O)OP([O-])(=O)OP(O)(O)=O)[C@@H](O)[C@H]2O)C(=O)N1 |
| C10H14N5Na2O14P3 | |
| MFCD03410297 | |
| guanosine 5'-triphosphate, guanosine-5'-triphosphate disodium salt dihydrate gtp, guanosine-triphosphate, guanosine 5'-triphosphate 4-, gtp 4-, 2r,3s,4r,5r-5-2-amino-6-hydroxy-9h-purin-9-yl-3,4-dihydroxyoxolan-2-yl methyl phosphonato oxy phosphonatooxy phosphinate, 2r,3s,4r,5r-5-2-amino-6-oxo-3h-purin-9-yl-3,4-dihydroxyoxolan-2-yl methoxy-oxidophosphoryl oxy-oxidophosphoryl phosphate | |
| disodium phosphono ({[(2R,3S,4R,5R)-5-(2-amino-6-oxo-6,9-dihydro-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphonato}oxy)phosphonate |
Specifications
| 56001-37-7 | |
| 0.981 | |
| MFCD03410297 | |
| guanosine 5'-triphosphate, guanosine-5'-triphosphate disodium salt dihydrate gtp, guanosine-triphosphate, guanosine 5'-triphosphate 4-, gtp 4-, 2r,3s,4r,5r-5-2-amino-6-hydroxy-9h-purin-9-yl-3,4-dihydroxyoxolan-2-yl methyl phosphonato oxy phosphonatooxy phosphinate, 2r,3s,4r,5r-5-2-amino-6-oxo-3h-purin-9-yl-3,4-dihydroxyoxolan-2-yl methoxy-oxidophosphoryl oxy-oxidophosphoryl phosphate | |
| [Na+].[Na+].NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP([O-])(=O)OP([O-])(=O)OP(O)(O)=O)[C@@H](O)[C@H]2O)C(=O)N1 | |
| 567.14 | |
| 567.2 | |
| Guanosine-5'-triphosphate, disodium |
| White | |
| C10H14N5Na2O14P3 | |
| 1 g | |
| FIZIYLKEXVIRHJ-KHRSEZDTNA-L | |
| disodium phosphono ({[(2R,3S,4R,5R)-5-(2-amino-6-oxo-6,9-dihydro-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphonato}oxy)phosphonate | |
| 131676145 | |
| Crystalline Powder |