missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
HEPES sodium salt, ≥99%, MP Biomedicals™
HEPES is widely used in many biochemical reactions and as a buffering agent in some cell culture media. It is used in a protein deposition technique in electron microscopy because it did not affect metal substrates
$113.40 - $819.58
Chemical Identifiers
| CAS | 75277-39-3 |
|---|---|
| Molecular Formula | C8H17N2NaO4S |
| Molecular Weight (g/mol) | 260.28 |
| MDL Number | MFCD00036463 |
| InChI Key | RDZTWEVXRGYCFV-UHFFFAOYSA-M |
| Synonym | 4-(2-Hydroxyethyl)piperazine-1-ethanesulfonic acid sodium salt, N-(2-Hydroxyethyl)piperazine-N'-(2-ethanesulfonic acid) sodium salt |
| PubChem CID | 2724248 |
| ChEBI | CHEBI:46758 |
| IUPAC Name | sodium 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethane-1-sulfonate |
| SMILES | [Na+].OCCN1CCN(CCS([O-])(=O)=O)CC1 |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
ICN19482825
|
MP Biomedicals Inc
0219482825 |
25 g |
Each for $113.40
|
|
|||||
|
ICN19482880
|
MP Biomedicals Inc
0219482880 |
100 g |
Each for $255.49
|
|
|||||
|
ICN19482890
|
MP Biomedicals Inc
0219482890 |
500 g |
Each for $819.58
|
|
|||||
Chemical Identifiers
| 75277-39-3 | |
| 260.28 | |
| RDZTWEVXRGYCFV-UHFFFAOYSA-M | |
| 2724248 | |
| sodium 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethane-1-sulfonate |
| C8H17N2NaO4S | |
| MFCD00036463 | |
| 4-(2-Hydroxyethyl)piperazine-1-ethanesulfonic acid sodium salt, N-(2-Hydroxyethyl)piperazine-N'-(2-ethanesulfonic acid) sodium salt | |
| CHEBI:46758 | |
| [Na+].OCCN1CCN(CCS([O-])(=O)=O)CC1 |
Specifications
| 75277-39-3 | |
| Powder | |
| ≥99% | |
| MFCD00036463 | |
| RDZTWEVXRGYCFV-UHFFFAOYSA-M | |
| sodium 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethane-1-sulfonate | |
| 2724248 | |
| 260.3 |
| White | |
| 25 g | |
| C8H17N2NaO4S | |
| 4-(2-Hydroxyethyl)piperazine-1-ethanesulfonic acid sodium salt, N-(2-Hydroxyethyl)piperazine-N'-(2-ethanesulfonic acid) sodium salt | |
| [Na+].OCCN1CCN(CCS([O-])(=O)=O)CC1 | |
| 260.28 | |
| CHEBI:46758 | |
| HEPES sodium salt |
Safety and Handling
EINECSNumber : 278-169-7