missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Inosine, 99%
CAS: 58-63-9 | C10H12N4O5 | 268.23 g/mol
$103.82 - $194.59
Chemical Identifiers
| CAS | 58-63-9 |
|---|---|
| Molecular Formula | C10H12N4O5 |
| Molecular Weight (g/mol) | 268.23 |
| MDL Number | MFCD00066770 |
| InChI Key | UGQMRVRMYYASKQ-YPLCUDRINA-N |
| Synonym | inosine, hypoxanthosine, ribonosine, atorel, oxiamin, trophicardyl, selfer, pantholic-l, panholic-l, hypoxanthine riboside |
| PubChem CID | 6021 |
| ChEBI | CHEBI:17596 |
| IUPAC Name | 9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-one |
| SMILES | OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)N1C=NC2=C1N=CNC2=O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC122250100
|
Thermo Scientific Chemicals
122250100 |
10 g | Glass bottle |
Each for $103.82
|
|
||||
|
AC122250250
|
Thermo Scientific Chemicals
122250250 |
25 g | Glass bottle |
Each for $194.59
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 58-63-9 | |
| 268.23 | |
| UGQMRVRMYYASKQ-YPLCUDRINA-N | |
| 6021 | |
| 9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-one |
| C10H12N4O5 | |
| MFCD00066770 | |
| inosine, hypoxanthosine, ribonosine, atorel, oxiamin, trophicardyl, selfer, pantholic-l, panholic-l, hypoxanthine riboside | |
| CHEBI:17596 | |
| OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)N1C=NC2=C1N=CNC2=O |
Specifications
| 58-63-9 | |
| 212°C to 213°C | |
| 1% max. | |
| 98.5% min. (HPLC) | |
| C10H12N4O5 | |
| 10 g | |
| 15, 5018 | |
| -49.2 | |
| Solubility in water: 2.1g/100 mL (20°C). Other solubilities: soluble in ethanol | |
| UGQMRVRMYYASKQ-YPLCUDRINA-N | |
| 9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-one | |
| 268.23 | |
| CHEBI:17596 | |
| 99% | |
| Inosine |
| 1.65 to 1.77 (A250/A260), 0.22 to 0.26 (A280/A260) | |
| White | |
| Authentic | |
| Glass bottle | |
| MFCD00066770 | |
| 31, 25 | |
| − 49.20 (18.00°C c=1,H2O) | |
| inosine, hypoxanthosine, ribonosine, atorel, oxiamin, trophicardyl, selfer, pantholic-l, panholic-l, hypoxanthine riboside | |
| 98 to 102% (lambda max. 248.5nm,pH 7) Molar absorptivity 12200+/-2%,on dry substance | |
| OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)N1C=NC2=C1N=CNC2=O | |
| 98% min. (c=1, H2O, 430nm, 1cm cell) | |
| 6021 | |
| 268.22 | |
| Crystalline Powder |
Safety and Handling
EINECSNumber : 200-390-4
RUO – Research Use Only