missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
L-Alanine tert-Butyl Ester Hydrochloride 97.0+%, TCI America™
$91.24 - $270.41
Chemical Identifiers
| CAS | 13404-22-3 |
|---|---|
| Molecular Formula | C7H16ClNO2 |
| Molecular Weight (g/mol) | 181.66 |
| MDL Number | MFCD00035524 |
| InChI Key | WIQIWPPQGWGVHD-JEDNCBNOSA-N |
| Synonym | h-ala-otbu.hcl, tert-butyl l-alaninate hydrochloride, l-alanine tert-butyl ester hydrochloride, s-tert-butyl 2-aminopropanoate hydrochloride, tert-butyl alaninate hydrochloride, h-ala-otbu inverted exclamation mark currencyhcl, tert-butyl 2s-2-aminopropanoate hydrochloride, l-alanine t-butyl ester hydrochloride, alanine, 1,1-dimethylethyl ester, hydrochloride, l-alanine, 1,1-dimethylethyl ester, hydrochloride |
| PubChem CID | 11275390 |
| IUPAC Name | tert-butyl (2S)-2-aminopropanoate hydrochloride |
| SMILES | Cl.C[C@H](N)C(=O)OC(C)(C)C |
Chemical Identifiers
| 13404-22-3 | |
| 181.66 | |
| WIQIWPPQGWGVHD-JEDNCBNOSA-N | |
| 11275390 | |
| Cl.C[C@H](N)C(=O)OC(C)(C)C |
| C7H16ClNO2 | |
| MFCD00035524 | |
| h-ala-otbu.hcl, tert-butyl l-alaninate hydrochloride, l-alanine tert-butyl ester hydrochloride, s-tert-butyl 2-aminopropanoate hydrochloride, tert-butyl alaninate hydrochloride, h-ala-otbu inverted exclamation mark currencyhcl, tert-butyl 2s-2-aminopropanoate hydrochloride, l-alanine t-butyl ester hydrochloride, alanine, 1,1-dimethylethyl ester, hydrochloride, l-alanine, 1,1-dimethylethyl ester, hydrochloride | |
| tert-butyl (2S)-2-aminopropanoate hydrochloride |
Specifications
| 13404-22-3 | |
| White | |
| MFCD00035524 | |
| h-ala-otbu.hcl, tert-butyl l-alaninate hydrochloride, l-alanine tert-butyl ester hydrochloride, s-tert-butyl 2-aminopropanoate hydrochloride, tert-butyl alaninate hydrochloride, h-ala-otbu inverted exclamation mark currencyhcl, tert-butyl 2s-2-aminopropanoate hydrochloride, l-alanine t-butyl ester hydrochloride, alanine, 1,1-dimethylethyl ester, hydrochloride, l-alanine, 1,1-dimethylethyl ester, hydrochloride | |
| Cl.C[C@H](N)C(=O)OC(C)(C)C | |
| 181.66 | |
| 181.66 | |
| Crystalline Powder |
| 208°C | |
| C7H16ClNO2 | |
| 1 g | |
| WIQIWPPQGWGVHD-JEDNCBNOSA-N | |
| tert-butyl (2S)-2-aminopropanoate hydrochloride | |
| 11275390 | |
| ≥97.0% (N) | |
| L-Alanine tert-Butyl Ester Hydrochloride |
Safety and Handling
TSCA : No