missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Thermo Scientific Chemicals L-Aspartyl-L-phenylalanine methyl ester, 98%
Supplier: Thermo Scientific Chemicals 228650250
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| 248.0°C to 250.0°C | |
| 22839-47-0 | |
| 98% | |
| Authentic | |
| MFCD00002724 | |
| 15, 829 | |
| aspartame, nutrasweet, asp-phe-ome, asp-phe methyl ester, aspartam, aspartamum, aspartamo, l-aspartyl-l-phenylalanine methyl ester, aspartylphenylalanine methyl ester, dipeptide sweetener | |
| IAOZJIPTCAWIRG-QWRGUYRKSA-N | |
| (3S)-3-amino-4-[[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]-4-oxobutanoic acid | |
| 294.31 | |
| CHEBI:2877 | |
| 294.3 | |
| + 12.50 (20.00°C c=4,15N formic acid) | |
| Crystalline Powder |
| L-Aspartyl-L-phenylalanine methyl ester | |
| White | |
| C14H18N2O5 | |
| HO2CCH2CH(NH2)CONHCH(CH2C6H5)CO2CH3 | |
| 4.5% max. (105°C, 4 hrs) | |
| Glass Bottle | |
| Solubility in water: sparingly soluble. | |
| COC(=O)[C@H](CC1=CC=CC=C1)NC(=O)[C@@H](N)CC(O)=O | |
| + 12.50 | |
| 134601 | |
| 95% min. (c=1, 2N HCl, 430nm) 1cm cell | |
| 98% | |
| 25 g |
Chemical Identifiers
| 22839-47-0 | |
| 294.31 | |
| IAOZJIPTCAWIRG-QWRGUYRKSA-N | |
| 134601 | |
| (3S)-3-amino-4-[[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]-4-oxobutanoic acid |
| C14H18N2O5 | |
| MFCD00002724 | |
| aspartame, nutrasweet, asp-phe-ome, asp-phe methyl ester, aspartam, aspartamum, aspartamo, l-aspartyl-l-phenylalanine methyl ester, aspartylphenylalanine methyl ester, dipeptide sweetener | |
| CHEBI:2877 | |
| COC(=O)[C@H](CC1=CC=CC=C1)NC(=O)[C@@H](N)CC(O)=O |
Safety and Handling
EINECSNumber : 245-261-3
RUO – Research Use Only