missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
L(+)-Potassium hydrogen tartrate, 99%, Thermo Scientific Chemicals
Supplier: Thermo Scientific Chemicals 222670010
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| L(+)-Potassium hydrogen tartrate | |
| Colorless or White | |
| 0.5% max. (105°C) | |
| 99% | |
| C4H5KO6 | |
| MFCD00065392,MFCD00071626,MFCD00064206 | |
| 03, 529 | |
| 15, 7736 | |
| + 32.50 | |
| KYKNRZGSIGMXFH-ZVGUSBNCSA-M | |
| 2,3-dihydroxybutanedioic acid;potassium | |
| 24193652 | |
| 99% |
| 868-14-4 | |
| 1.9500g/mL | |
| Authentic | |
| Plastic bottle | |
| KO2CCH(OH)CH(OH)CO2H | |
| 1 kg | |
| 1.95 | |
| + 32.50 (20.00°C c=10,1N NaOH) | |
| potassium bitartrate, l +-potassium hydrogen tartrate, potassium 3-carboxy-2,3-dihydroxypropanoate, monopotassium tartrate, potassium acid tartrate, kaliumtartrat, potassium hydrogentartrate, 1-potassium hydrogentartrate, ksc657e1t, butanedioic acid, 2,3-dihydroxy-2r,3r-, potassium salt 1:1 | |
| [K+].O[C@H]([C@@H](O)C([O-])=O)C(O)=O | |
| 188.18 | |
| 188.18 | |
| Crystals or Powder |
Chemical Identifiers
| 868-14-4 | |
| 188.18 | |
| KYKNRZGSIGMXFH-ZVGUSBNCSA-M | |
| 24193652 | |
| [K+].O[C@H]([C@@H](O)C([O-])=O)C(O)=O |
| C4H5KO6 | |
| MFCD00065392,MFCD00071626,MFCD00064206 | |
| potassium bitartrate, l +-potassium hydrogen tartrate, potassium 3-carboxy-2,3-dihydroxypropanoate, monopotassium tartrate, potassium acid tartrate, kaliumtartrat, potassium hydrogentartrate, 1-potassium hydrogentartrate, ksc657e1t, butanedioic acid, 2,3-dihydroxy-2r,3r-, potassium salt 1:1 | |
| 2,3-dihydroxybutanedioic acid;potassium |
Safety and Handling
EINECSNumber : 212-769-1
RUO – Research Use Only