missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
L-threonine methyleester hydrochloride, +98%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 376690050
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| L-Threonine methyleester hydrochloride | |
| Authentic | |
| C5H12NO3 | |
| CH3CH(OH)CH(NH2)C(O)OCH3·HCl | |
| -9.5° to -10.5° (20°C, 589nm) (c=1, Methanol, 20°C) | |
| 1% Max. | |
| COC(=O)[C@@H]([NH3+])[C@@H](C)O | |
| −10° (20°C c=1,methanol) | |
| 134.15 | |
| 169.61 |
| 39994-75-7 | |
| 98+% | |
| Glass bottle | |
| MFCD00037677 | |
| l-threonine methyl ester hydrochloride, methyl l-threoninate hydrochloride, h-thr-ome.hcl, 2s,3r-methyl 2-amino-3-hydroxybutanoate hydrochloride, l-threonine, methyl ester, hydrochloride, l-threonine methyl ester hcl, threonine methyl ester hydrochloride, methyl 2s,3r-2-amino-3-hydroxybutanoate hydrochloride, methyl l-threoninate hcl, h-thr-ome?cl | |
| TVHCXXXXQNWQLP-DMTCNVIQSA-O | |
| methyl (2S,3R)-2-amino-3-hydroxybutanoate;hydrochloride | |
| 5g | |
| 2734893 | |
| ≥98.0% ((on dry substance)) |
Chemical Identifiers
| 39994-75-7 | |
| 134.15 | |
| TVHCXXXXQNWQLP-DMTCNVIQSA-O | |
| 2734893 | |
| COC(=O)[C@@H]([NH3+])[C@@H](C)O |
| C5H12NO3 | |
| MFCD00037677 | |
| l-threonine methyl ester hydrochloride, methyl l-threoninate hydrochloride, h-thr-ome.hcl, 2s,3r-methyl 2-amino-3-hydroxybutanoate hydrochloride, l-threonine, methyl ester, hydrochloride, l-threonine methyl ester hcl, threonine methyl ester hydrochloride, methyl 2s,3r-2-amino-3-hydroxybutanoate hydrochloride, methyl l-threoninate hcl, h-thr-ome?cl | |
| methyl (2S,3R)-2-amino-3-hydroxybutanoate;hydrochloride |
RUO â Research Use Only