missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Methyl linolenate, 99%, Thermo Scientific Chemicals
Supplier: Thermo Scientific Chemicals 368100010
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Methyl linolenate | |
| 301-00-8 | |
| 0.8950g/mL | |
| >110°C | |
| 98.5% min. (GC) | |
| C19H32O2 | |
| CH3(CH2CH=CH)3(CH2)7CO2CH3 | |
| 1 g | |
| 0.895 | |
| Solubility in water: insoluble | |
| CC\C=C/C\C=C/C\C=C/CCCCCCCC(=O)OC | |
| 292.46 | |
| 292.46 | |
| Liquid |
| 99% | |
| Colorless | |
| 182.0°C (3.0 mmHg) | |
| Authentic | |
| Glass bottle | |
| 1.4700 to 1.4720 | |
| MFCD00135851 | |
| 02, IV, 1782 | |
| methyl linolenate, linolenic acid methyl ester, methyl alpha-linolenate, linolenic acid, methyl ester, unii-0s1ns923k6, alpha-linolenic acid methyl ester, methyl all-cis-9,12,15-octadecatrienoate, methyl 9z,12z,15z-octadeca-9,12,15-trienoate, 9,12,15-octadecatrienoic acid, methyl ester, z,z,z, methyl cis,cis,cis-octadec-9,12,15-trienoate | |
| DVWSXZIHSUZZKJ-YSTUJMKBSA-N | |
| methyl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate | |
| 5319706 | |
| 99% |
Chemical Identifiers
| 301-00-8 | |
| 292.46 | |
| DVWSXZIHSUZZKJ-YSTUJMKBSA-N | |
| 5319706 | |
| CC\C=C/C\C=C/C\C=C/CCCCCCCC(=O)OC |
| C19H32O2 | |
| MFCD00135851 | |
| methyl linolenate, linolenic acid methyl ester, methyl alpha-linolenate, linolenic acid, methyl ester, unii-0s1ns923k6, alpha-linolenic acid methyl ester, methyl all-cis-9,12,15-octadecatrienoate, methyl 9z,12z,15z-octadeca-9,12,15-trienoate, 9,12,15-octadecatrienoic acid, methyl ester, z,z,z, methyl cis,cis,cis-octadec-9,12,15-trienoate | |
| methyl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
Safety and Handling
EINECSNumber : 206-102-3
RUO – Research Use Only