missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
N-(6-Aminohexyl)-1-naphthalenesulfonamide Hydrochloride 98.0+%, TCI America™
Supplier: TCI America A2410500MG
Specifications
| N-(6-Aminohexyl)-1-naphthalenesulfonamide Hydrochloride | |
| 164°C | |
| C16H23ClN2O2S | |
| 500 mg | |
| HOCSVIGHWPLMFC-UHFFFAOYSA-N | |
| hydrogen N-(6-aminohexyl)naphthalene-1-sulfonamide chloride | |
| 173829 | |
| ≥98.0% (HPLC,N) |
| 61714-25-8 | |
| White-Yellow | |
| MFCD00058043 | |
| w-5 hydrochloride, n-6-aminohexyl-1-naphthalenesulfonamide hydrochloride, w-5, hydrochloride, n-6-aminohexyl naphthalene-1-sulfonamide hydrochloride, n-6-aminohexyl-1-naphthalenesulphonamide hydrochloride, n-6-aminohexyl-1-naphthalenesulfonamide hcl, n-6-aminohexyl-1-naphthalenesulfonamide, hcl, acmc-209mvm, n-6-aminohexyl-1-naphthalenesulfonamide monohydrochlorde, 1-naphthalenesulfonamide, n-6-aminohexyl-, monohydrochlorde | |
| [H+].[Cl-].NCCCCCCNS(=O)(=O)C1=C2C=CC=CC2=CC=C1 | |
| 342.88 | |
| 342.88 | |
| Crystalline Powder |
Chemical Identifiers
| 61714-25-8 | |
| 342.88 | |
| HOCSVIGHWPLMFC-UHFFFAOYSA-N | |
| 173829 | |
| [H+].[Cl-].NCCCCCCNS(=O)(=O)C1=C2C=CC=CC2=CC=C1 |
| C16H23ClN2O2S | |
| MFCD00058043 | |
| w-5 hydrochloride, n-6-aminohexyl-1-naphthalenesulfonamide hydrochloride, w-5, hydrochloride, n-6-aminohexyl naphthalene-1-sulfonamide hydrochloride, n-6-aminohexyl-1-naphthalenesulphonamide hydrochloride, n-6-aminohexyl-1-naphthalenesulfonamide hcl, n-6-aminohexyl-1-naphthalenesulfonamide, hcl, acmc-209mvm, n-6-aminohexyl-1-naphthalenesulfonamide monohydrochlorde, 1-naphthalenesulfonamide, n-6-aminohexyl-, monohydrochlorde | |
| hydrogen N-(6-aminohexyl)naphthalene-1-sulfonamide chloride |
Safety and Handling
TSCA : No
Recommended Storage : Freezer