Learn More
N,N-Diethyl-p-phenylenediamine sulfate, 99%
N, N-Diethyl-p-phenylenediamine sulfate, 99%, C10H16N2.H2SO4, CAS Number-6283-63-2 | CAS: 6283-63-2 | C10H16N2·H2SO4 | 262.33 g/mol
$81.60 - $590.98
Chemical Identifiers
| CAS | 6283-63-2 |
|---|---|
| Molecular Formula | C10H16N2·H2SO4 |
| Molecular Weight (g/mol) | 262.33 |
| MDL Number | MFCD00012993 |
| InChI Key | AYLDJQABCMPYEN-UHFFFAOYSA-N |
| Synonym | n,n-diethyl-p-phenylenediamine sulfate, n1,n1-diethylbenzene-1,4-diamine sulfate, 4-amino-n,n-diethylaniline sulfate, diethyl-p-phenylenediamine sulfate, n,n-diethyl-1,4-phenylenediamine sulfate, unii-usp19t3gda, 1,4-benzenediamine, n,n-diethyl-, sulfate 1:1, 1,4-benzenediamine, n,n-diethyl-, sulfate, n,n-diethyl-1,4-benzenediamine sulfate, p-phenylenediamine, n,n-diethyl-, sulfate 1:1 |
| PubChem CID | 80166 |
| IUPAC Name | 4-N,4-N-diethylbenzene-1,4-diamine;sulfuric acid |
| SMILES | CCN(CC)C1=CC=C(C=C1)N.OS(=O)(=O)O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC395000500
|
Thermo Scientific Chemicals
395000500 |
50 g | Glass bottle |
Each for $81.60
|
|
||||
|
AC395002500
|
Thermo Scientific Chemicals
395002500 |
250 g | Glass bottle |
Each for $208.22
|
|
||||
|
AC395000010
|
Thermo Scientific Chemicals
395000010 |
1 kg | Glass bottle |
Each for $590.98
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 6283-63-2 | |
| 262.33 | |
| AYLDJQABCMPYEN-UHFFFAOYSA-N | |
| 80166 | |
| CCN(CC)C1=CC=C(C=C1)N.OS(=O)(=O)O |
| C10H16N2·H2SO4 | |
| MFCD00012993 | |
| n,n-diethyl-p-phenylenediamine sulfate, n1,n1-diethylbenzene-1,4-diamine sulfate, 4-amino-n,n-diethylaniline sulfate, diethyl-p-phenylenediamine sulfate, n,n-diethyl-1,4-phenylenediamine sulfate, unii-usp19t3gda, 1,4-benzenediamine, n,n-diethyl-, sulfate 1:1, 1,4-benzenediamine, n,n-diethyl-, sulfate, n,n-diethyl-1,4-benzenediamine sulfate, p-phenylenediamine, n,n-diethyl-, sulfate 1:1 | |
| 4-N,4-N-diethylbenzene-1,4-diamine;sulfuric acid |
Specifications
| 6283-63-2 | |
| 100.0 | |
| White to Beige | |
| 99% | |
| C10H16N2·H2SO4 | |
| 50 g | |
| AYLDJQABCMPYEN-UHFFFAOYSA-N | |
| 4-N,4-N-diethylbenzene-1,4-diamine;sulfuric acid | |
| 80166 | |
| 99% | |
| N, N-Diethyl-p-phenylenediamine sulfate |
| 98.5 | |
| 184.0°C to 187.0°C | |
| Authentic | |
| Glass bottle | |
| MFCD00012993 | |
| n,n-diethyl-p-phenylenediamine sulfate, n1,n1-diethylbenzene-1,4-diamine sulfate, 4-amino-n,n-diethylaniline sulfate, diethyl-p-phenylenediamine sulfate, n,n-diethyl-1,4-phenylenediamine sulfate, unii-usp19t3gda, 1,4-benzenediamine, n,n-diethyl-, sulfate 1:1, 1,4-benzenediamine, n,n-diethyl-, sulfate, n,n-diethyl-1,4-benzenediamine sulfate, p-phenylenediamine, n,n-diethyl-, sulfate 1:1 | |
| CCN(CC)C1=CC=C(C=C1)N.OS(=O)(=O)O | |
| 262.33 | |
| 262.33 | |
| Crystalline Powder or Crystals With Lumps |
Safety and Handling
GHS H Statement
Harmful if swallowed.
Harmful in contact with skin.
GHS P Statement
Wear protective gloves/protective clothing.
Call a POISON CENTER or doctor/physician if you feel unwell.
IF ON SKIN: Wash with plenty of soap and water.
IF SWALLOWED: rinse mouth.
Do NOT induce vomiting.
GHS Signal Word: Warning
EINECSNumber : 228-500-6
RUO – Research Use Only