missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Nalidixic acid sodium salt, 98.1%, MP Biomedicals™
$65.29 - $115.04
Chemical Identifiers
| CAS | 389-08-2 |
|---|---|
| Molecular Formula | C12H12N2O3 |
| Molecular Weight (g/mol) | 232.239 |
| InChI Key | MHWLWQUZZRMNGJ-UHFFFAOYSA-N |
| Synonym | nalidixic acid, nalidixin, nevigramon, nalidixate, uronidix, innoxalon, nalidixan, nalitucsan, sicmylon, unaserus |
| PubChem CID | 4421 |
| ChEBI | CHEBI:100147 |
| IUPAC Name | 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylic acid |
| SMILES | CCN1C=C(C(=O)C2=C1N=C(C=C2)C)C(=O)O |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
ICN15172401
|
MP Biomedicals Inc
0215172401 |
1 g |
Each for $65.29
|
|
|||||
|
ICN15172405
|
MP Biomedicals Inc
0215172405 |
5 g |
Each for $115.04
|
|
|||||
Chemical Identifiers
| 389-08-2 | |
| 232.239 | |
| nalidixic acid, nalidixin, nevigramon, nalidixate, uronidix, innoxalon, nalidixan, nalitucsan, sicmylon, unaserus | |
| CHEBI:100147 | |
| CCN1C=C(C(=O)C2=C1N=C(C=C2)C)C(=O)O |
| C12H12N2O3 | |
| MHWLWQUZZRMNGJ-UHFFFAOYSA-N | |
| 4421 | |
| 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylic acid |
Specifications
| 389-08-2 | |
| ∽ 98% | |
| 1 g | |
| MHWLWQUZZRMNGJ-UHFFFAOYSA-N | |
| 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylic acid | |
| 4421 | |
| 254.2 | |
| Nalidixic Acid Sodium Salt |
| White | |
| C12H12N2O3 | |
| nalidixic acid, nalidixin, nevigramon, nalidixate, uronidix, innoxalon, nalidixan, nalitucsan, sicmylon, unaserus | |
| CCN1C=C(C(=O)C2=C1N=C(C=C2)C)C(=O)O | |
| 232.239 | |
| CHEBI:100147 | |
| Powder |
Safety and Handling
storageNote1 : Use only in area provided with appropriate exhaust ventilation
Recommended Storage : Store at 0°C.