missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Phenazine methosulfate, MP Biomedicals™
$103.82 - $496.07
Chemical Identifiers
| CAS | 299-11-6 |
|---|---|
| Molecular Formula | C14H14N2O4S |
| Molecular Weight (g/mol) | 306.336 |
| InChI Key | RXGJTUSBYWCRBK-UHFFFAOYSA-M |
| Synonym | phenazine methosulfate, 5-methylphenazin-5-ium methyl sulfate, 5-methylphenazinium methyl sulfate, n-methylphenazonium methosulfate, phenazine methosulphate, methylphenazonium methosulfate, 5-methylphenazine methylsulfate, n-methylphenazinium methosulfate, n-methylphenazonium methosulphate, phenazinium, 5-methyl-, methyl sulfate |
| PubChem CID | 9285 |
| ChEBI | CHEBI:8055 |
| IUPAC Name | 5-methylphenazin-5-ium;methyl sulfate |
| SMILES | C[N+]1=C2C=CC=CC2=NC3=CC=CC=C31.COS(=O)(=O)[O-] |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
ICN10095501
|
MP Biomedicals Inc
0210095501 |
1 g |
Each for $103.82
|
|
|||||
|
ICN10095505
|
MP Biomedicals Inc
0210095505 |
5 g |
Each for $334.17
|
|
|||||
|
ICN10095510
|
MP Biomedicals Inc
0210095510 |
10 g |
Each for $496.07
|
|
|||||
Chemical Identifiers
| 299-11-6 | |
| 306.336 | |
| phenazine methosulfate, 5-methylphenazin-5-ium methyl sulfate, 5-methylphenazinium methyl sulfate, n-methylphenazonium methosulfate, phenazine methosulphate, methylphenazonium methosulfate, 5-methylphenazine methylsulfate, n-methylphenazinium methosulfate, n-methylphenazonium methosulphate, phenazinium, 5-methyl-, methyl sulfate | |
| CHEBI:8055 | |
| C[N+]1=C2C=CC=CC2=NC3=CC=CC=C31.COS(=O)(=O)[O-] |
| C14H14N2O4S | |
| RXGJTUSBYWCRBK-UHFFFAOYSA-M | |
| 9285 | |
| 5-methylphenazin-5-ium;methyl sulfate |
Specifications
| 299-11-6 | |
| C14H14N2O4S | |
| phenazine methosulfate, 5-methylphenazin-5-ium methyl sulfate, 5-methylphenazinium methyl sulfate, n-methylphenazonium methosulfate, phenazine methosulphate, methylphenazonium methosulfate, 5-methylphenazine methylsulfate, n-methylphenazinium methosulfate, n-methylphenazonium methosulphate, phenazinium, 5-methyl-, methyl sulfate | |
| C[N+]1=C2C=CC=CC2=NC3=CC=CC=C31.COS(=O)(=O)[O-] | |
| 306.336 | |
| CHEBI:8055 | |
| Crystals |
| Yellow | |
| 1 g | |
| RXGJTUSBYWCRBK-UHFFFAOYSA-M | |
| 5-methylphenazin-5-ium;methyl sulfate | |
| 9285 | |
| 306.3 | |
| Phenazine methosulfate |
Safety and Handling
Recommended Storage : Store at 2° to 8°C.