missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Phenyl ether, 99%, Thermo Scientific Chemicals
$69.87 - $232.17
Chemical Identifiers
| CAS | 101-84-8 |
|---|---|
| Molecular Formula | C12H10O |
| Molecular Weight (g/mol) | 170.21 |
| MDL Number | MFCD00003034 |
| InChI Key | USIUVYZYUHIAEV-UHFFFAOYSA-N |
| Synonym | diphenyl ether, diphenyl oxide, phenyl ether, oxydibenzene, phenyl oxide, oxybisbenzene, biphenyl oxide, 1,1'-oxydibenzene, benzene, 1,1'-oxybis, oxydiphenyl |
| PubChem CID | 7583 |
| ChEBI | CHEBI:39258 |
| IUPAC Name | phenoxybenzene |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC=C2 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC130601000
|
Thermo Scientific Chemicals
130601000 |
100 g | Glass bottle |
Each for $69.87
|
|
||||
|
AC130605000
|
Thermo Scientific Chemicals
130605000 |
500 g | Glass bottle |
Each for $76.35
|
|
||||
|
AC130600010
|
Thermo Scientific Chemicals
130600010 |
1 kg | Glass bottle |
Each for $102.79
|
|
||||
|
AC130600025
|
Thermo Scientific Chemicals
130600025 |
2.5 kg | Glass bottle |
Each for $232.17
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 101-84-8 | |
| 170.21 | |
| USIUVYZYUHIAEV-UHFFFAOYSA-N | |
| 7583 | |
| phenoxybenzene |
| C12H10O | |
| MFCD00003034 | |
| diphenyl ether, diphenyl oxide, phenyl ether, oxydibenzene, phenyl oxide, oxybisbenzene, biphenyl oxide, 1,1'-oxydibenzene, benzene, 1,1'-oxybis, oxydiphenyl | |
| CHEBI:39258 | |
| C1=CC=C(C=C1)OC2=CC=CC=C2 |
Specifications
| 101-84-8 | |
| 1.0730g/mL | |
| 115°C | |
| Glass bottle | |
| 1.5795 to 1.5815 | |
| MFCD00003034 | |
| 06,146 | |
| 15,3357 | |
| Solubility in water: insoluble. Other solubilities: soluble in alcohol,benzene,ether and,glacial acetic acid | |
| C1=CC=C(C=C1)OC2=CC=CC=C2 | |
| 170.21 | |
| 3.4909 mPa.s (28°C) | |
| 170.21 | |
| Phenyl ether |
| 26.0°C to 30.0°C | |
| 259.0°C | |
| 98.5% min. (GC) | |
| C12H10O | |
| (C6H5)2O | |
| 100 g | |
| 1.073 | |
| diphenyl ether, diphenyl oxide, phenyl ether, oxydibenzene, phenyl oxide, oxybisbenzene, biphenyl oxide, 1,1'-oxydibenzene, benzene, 1,1'-oxybis, oxydiphenyl | |
| USIUVYZYUHIAEV-UHFFFAOYSA-N | |
| phenoxybenzene | |
| 7583 | |
| CHEBI:39258 | |
| 99% |
Safety and Handling
GHS H Statement
Causes serious eye irritation.
Toxic to aquatic life with long lasting effects.
GHS P Statement
Avoid breathing dust/fume/gas/mist/vapors/spray.
Avoid release to the environment.
IF ON SKIN: Wash with plenty of soap and water.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN
GHS Signal Word: Warning
EINECSNumber : 202-981-2
RUO – Research Use Only