missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Safranine, 1% (w/v), Counterstain for Gram Staining, Ricca Chemical
Supplier: Ricca Chemical Company 66601
Specifications
| Safranine | |
| 477-73-6,7732-18-5 | |
| 100.0,1.01 | |
| C20H19ClN4 | |
| QRYAEWIQIBAZOJ-UHFFFAOYSA-N | |
| 2,7-diamino-1,8-dimethyl-5-phenyl-5λâµ-phenazin-5-ylium chloride | |
| 2723800 | |
| Aqueous Solution | |
| 4 L |
| Counterstain for Gram Staining | |
| 97.0,0.97 | |
| 1% (w/v) | |
| MFCD00011759 | |
| [Cl-].CC1=C(N)C=C2C(=C1)N=C1C(C)=C(N)C=CC1=[N+]2C1=CC=CC=C1 | |
| 350.85 | |
| Natural Poly Bottle | |
| Red | |
| Liquid |
Chemical Identifiers
| 477-73-6 | |
| 350.85 | |
| QRYAEWIQIBAZOJ-UHFFFAOYSA-N | |
| 2,7-diamino-1,8-dimethyl-5-phenyl-5λâµ-phenazin-5-ylium chloride |
| C20H19ClN4 | |
| MFCD00011759 | |
| 2723800 | |
| [Cl-].CC1=C(N)C=C2C(=C1)N=C1C(C)=C(N)C=CC1=[N+]2C1=CC=CC=C1 |