missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Terephthaloyl Chloride 99.0+%, TCI America™
$31.14 - $98.62
Chemical Identifiers
| CAS | 100-20-9 |
|---|---|
| Molecular Formula | C8H4Cl2O2 |
| Molecular Weight (g/mol) | 203.02 |
| MDL Number | MFCD00000693 |
| InChI Key | LXEJRKJRKIFVNY-UHFFFAOYSA-N |
| Synonym | terephthaloyl chloride, terephthaloyl dichloride, 1,4-benzenedicarbonyl dichloride, terephthalic acid dichloride, terephthalic dichloride, p-phthaloyl chloride, terephthalic acid chloride, p-phthalyl dichloride, p-phthaloyl dichloride, terephthalyl dichloride |
| PubChem CID | 7488 |
| IUPAC Name | benzene-1,4-dicarbonyl dichloride |
| SMILES | ClC(=O)C1=CC=C(C=C1)C(Cl)=O |
Chemical Identifiers
| 100-20-9 | |
| 203.02 | |
| LXEJRKJRKIFVNY-UHFFFAOYSA-N | |
| 7488 | |
| ClC(=O)C1=CC=C(C=C1)C(Cl)=O |
| C8H4Cl2O2 | |
| MFCD00000693 | |
| terephthaloyl chloride, terephthaloyl dichloride, 1,4-benzenedicarbonyl dichloride, terephthalic acid dichloride, terephthalic dichloride, p-phthaloyl chloride, terephthalic acid chloride, p-phthalyl dichloride, p-phthaloyl dichloride, terephthalyl dichloride | |
| benzene-1,4-dicarbonyl dichloride |
Specifications
| 100-20-9 | |
| White | |
| C8H4Cl2O2 | |
| 25 g | |
| terephthaloyl chloride, terephthaloyl dichloride, 1,4-benzenedicarbonyl dichloride, terephthalic acid dichloride, terephthalic dichloride, p-phthaloyl chloride, terephthalic acid chloride, p-phthalyl dichloride, p-phthaloyl dichloride, terephthalyl dichloride | |
| ClC(=O)C1=CC=C(C=C1)C(Cl)=O | |
| 203.02 | |
| 203.02 | |
| Crystalline Powder |
| 83°C | |
| 266°C | |
| MFCD00000693 | |
| 2923 | |
| LXEJRKJRKIFVNY-UHFFFAOYSA-N | |
| benzene-1,4-dicarbonyl dichloride | |
| 7488 | |
| ≥99.0% (GC,T) | |
| Terephthaloyl Chloride |
Safety and Handling
EINECSNumber : (3)-1378
RTECSNumber : WZ1797000
TSCA : Yes