missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Triethyl Citrate 99.0+%, TCI America™
Supplier: TCI America C0367500G
Specifications
| Triethyl Citrate | |
| -45°C | |
| 294°C | |
| MFCD00009201 | |
| triethyl citrate, ethyl citrate, citroflex 2, eudraflex, hydragen cat, citric acid, triethyl ester, triaethylcitrat, triethylcitrate, citric acid triethyl ester, 1,2,3-propanetricarboxylic acid, 2-hydroxy-, triethyl ester | |
| CCOC(=O)CC(CC(=O)OCC)(C(=O)OCC)O | |
| 276.285 | |
| 276.29 | |
| Liquid |
| 77-93-0 | |
| Yellow | |
| C12H20O7 | |
| 500 g | |
| DOOTYTYQINUNNV-UHFFFAOYSA-N | |
| triethyl 2-hydroxypropane-1,2,3-tricarboxylate | |
| 6506 | |
| ≥99.0% (GC) |
Chemical Identifiers
| 77-93-0 | |
| 276.285 | |
| DOOTYTYQINUNNV-UHFFFAOYSA-N | |
| 6506 | |
| CCOC(=O)CC(CC(=O)OCC)(C(=O)OCC)O |
| C12H20O7 | |
| MFCD00009201 | |
| triethyl citrate, ethyl citrate, citroflex 2, eudraflex, hydragen cat, citric acid, triethyl ester, triaethylcitrat, triethylcitrate, citric acid triethyl ester, 1,2,3-propanetricarboxylic acid, 2-hydroxy-, triethyl ester | |
| triethyl 2-hydroxypropane-1,2,3-tricarboxylate |
Safety and Handling
EINECSNumber : (2)-1320
RTECSNumber : GE8050000
TSCA : Yes