missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Triphenylmethanol 99.0+%, TCI America™
$65.29 - $323.03
Chemical Identifiers
| CAS | 76-84-6 |
|---|---|
| Molecular Formula | C19H16O |
| Molecular Weight (g/mol) | 260.34 |
| MDL Number | MFCD00004445,MFCD10565638 |
| InChI Key | LZTRCELOJRDYMQ-UHFFFAOYSA-N |
| Synonym | triphenylcarbinol, trityl alcohol, tritanol, triphenylmethyl alcohol, triphenyl methanol, triphenyl carbinol, methanol, triphenyl, unii-u97q0ou9kb, triphenyl-methanol, benzenemethanol, .alpha.,.alpha.-diphenyl |
| PubChem CID | 6457 |
| IUPAC Name | triphenylmethanol |
| SMILES | OC(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
Chemical Identifiers
| 76-84-6 | |
| 260.34 | |
| LZTRCELOJRDYMQ-UHFFFAOYSA-N | |
| 6457 | |
| OC(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| C19H16O | |
| MFCD00004445,MFCD10565638 | |
| triphenylcarbinol, trityl alcohol, tritanol, triphenylmethyl alcohol, triphenyl methanol, triphenyl carbinol, methanol, triphenyl, unii-u97q0ou9kb, triphenyl-methanol, benzenemethanol, .alpha.,.alpha.-diphenyl | |
| triphenylmethanol |
Specifications
| 76-84-6 | |
| 380°C | |
| MFCD00004445,MFCD10565638 | |
| triphenylcarbinol, trityl alcohol, tritanol, triphenylmethyl alcohol, triphenyl methanol, triphenyl carbinol, methanol, triphenyl, unii-u97q0ou9kb, triphenyl-methanol, benzenemethanol, .alpha.,.alpha.-diphenyl | |
| OC(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 | |
| 260.34 | |
| 260.34 | |
| Crystalline Powder |
| 163°C | |
| C19H16O | |
| 25 g | |
| LZTRCELOJRDYMQ-UHFFFAOYSA-N | |
| triphenylmethanol | |
| 6457 | |
| ≥99.0% (GC) | |
| Triphenylmethanol |
Safety and Handling
TSCA : Yes