missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Triphosgene 98.0+%, TCI America™
$161.51 - $841.94
Chemical Identifiers
| CAS | 32315-10-9 |
|---|---|
| Molecular Formula | C3Cl6O3 |
| Molecular Weight (g/mol) | 296.73 |
| MDL Number | MFCD00062848 |
| InChI Key | UCPYLLCMEDAXFR-UHFFFAOYSA-N |
| Synonym | triphosgene, bis trichloromethyl carbonate, methanol, trichloro-, carbonate 2:1, ditrichloromethyl carbonate, triphosgene bis-trichloromethyl carbonate, methanol, 1,1,1-trichloro-, 1,1'-carbonate, triphosgen, tri phosgene, tri-phosgene |
| PubChem CID | 94429 |
| IUPAC Name | bis(trichloromethyl) carbonate |
| SMILES | C(=O)(OC(Cl)(Cl)Cl)OC(Cl)(Cl)Cl |
Chemical Identifiers
| 32315-10-9 | |
| 296.73 | |
| UCPYLLCMEDAXFR-UHFFFAOYSA-N | |
| 94429 | |
| C(=O)(OC(Cl)(Cl)Cl)OC(Cl)(Cl)Cl |
| C3Cl6O3 | |
| MFCD00062848 | |
| triphosgene, bis trichloromethyl carbonate, methanol, trichloro-, carbonate 2:1, ditrichloromethyl carbonate, triphosgene bis-trichloromethyl carbonate, methanol, 1,1,1-trichloro-, 1,1'-carbonate, triphosgen, tri phosgene, tri-phosgene | |
| bis(trichloromethyl) carbonate |
Specifications
| 32315-10-9 | |
| White-Yellow | |
| C3Cl6O3 | |
| 25 g | |
| triphosgene, bis trichloromethyl carbonate, methanol, trichloro-, carbonate 2:1, ditrichloromethyl carbonate, triphosgene bis-trichloromethyl carbonate, methanol, 1,1,1-trichloro-, 1,1'-carbonate, triphosgen, tri phosgene, tri-phosgene | |
| C(=O)(OC(Cl)(Cl)Cl)OC(Cl)(Cl)Cl | |
| 296.73 | |
| 296.73 | |
| Crystalline Powder |
| 80°C | |
| 206°C | |
| MFCD00062848 | |
| 2928 | |
| UCPYLLCMEDAXFR-UHFFFAOYSA-N | |
| bis(trichloromethyl) carbonate | |
| 94429 | |
| ≥98.0% (T) | |
| Triphosgene |
Safety and Handling
TSCA : Yes
Recommended Storage : Refrigerator