missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Undecafluorohexanoic Acid High Grade 98.0+%, TCI America™
Supplier: TCI America A57225G
Specifications
| Undecafluorohexanoic Acid High Grade [Ion-Pair Reagent for LC-MS] | |
| 14°C | |
| 157°C | |
| MFCD00198040 | |
| 3265 | |
| PXUULQAPEKKVAH-UHFFFAOYSA-N | |
| 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanoic acid | |
| 67542 | |
| 314.05 | |
| Liquid |
| 307-24-4 | |
| Colorless | |
| C6HF11O2 | |
| 5 g | |
| Perfluorohexanoic Acid High Grade, IPC-PFFA-6 HG | |
| C(=O)(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)O | |
| 314.054 | |
| CHEBI:83492 | |
| ≥98.0% (T) |
Chemical Identifiers
| 307-24-4 | |
| 314.054 | |
| PXUULQAPEKKVAH-UHFFFAOYSA-N | |
| 67542 | |
| 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanoic acid |
| C6HF11O2 | |
| MFCD00198040 | |
| Perfluorohexanoic Acid High Grade, IPC-PFFA-6 HG | |
| CHEBI:83492 | |
| C(=O)(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)O |
Safety and Handling
EINECSNumber : (2)-1182
TSCA : Yes