missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
1,3-Diphenylacetone, 99%, Thermo Scientific Chemicals
$88.97 - $1225.26
Chemical Identifiers
| CAS | 102-04-5 |
|---|---|
| Molecular Formula | C15H14O |
| Molecular Weight (g/mol) | 210.28 |
| MDL Number | MFCD00004795 |
| InChI Key | YFKBXYGUSOXJGS-UHFFFAOYSA-N |
| Synonym | 1,3-diphenylacetone, dibenzyl ketone, 1,3-diphenyl-2-propanone, benzyl ketone, 2-propanone, 1,3-diphenyl, 1,3-diphenylpropanone, alpha,alpha'-diphenylacetone, 1,3-diphenyl-propan-2-one, unii-9y07g5udkq, fema no. 2397 |
| PubChem CID | 7593 |
| IUPAC Name | 1,3-diphenylpropan-2-one |
| SMILES | O=C(CC1=CC=CC=C1)CC1=CC=CC=C1 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC117170250
|
Thermo Scientific Chemicals
117170250 |
25 g | Glass bottle |
Each for $88.97
|
|
||||
|
AC117171000
|
Thermo Scientific Chemicals
117171000 |
100 g | Glass bottle |
Each for $285.73
|
|
||||
|
AC117175000
|
Thermo Scientific Chemicals
117175000 |
500 g | Glass bottle |
Each for $1,225.26
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 102-04-5 | |
| 210.28 | |
| YFKBXYGUSOXJGS-UHFFFAOYSA-N | |
| 7593 | |
| O=C(CC1=CC=CC=C1)CC1=CC=CC=C1 |
| C15H14O | |
| MFCD00004795 | |
| 1,3-diphenylacetone, dibenzyl ketone, 1,3-diphenyl-2-propanone, benzyl ketone, 2-propanone, 1,3-diphenyl, 1,3-diphenylpropanone, alpha,alpha'-diphenylacetone, 1,3-diphenyl-propan-2-one, unii-9y07g5udkq, fema no. 2397 | |
| 1,3-diphenylpropan-2-one |
Specifications
| 102-04-5 | |
| 100.0 | |
| Yellow | |
| 330.0°C | |
| Authentic | |
| Glass bottle | |
| C6H5CH2COCH2C6H5 | |
| 25 g | |
| 01,198; 04,123 | |
| 1,3-diphenylacetone, dibenzyl ketone, 1,3-diphenyl-2-propanone, benzyl ketone, 2-propanone, 1,3-diphenyl, 1,3-diphenylpropanone, alpha,alpha'-diphenylacetone, 1,3-diphenyl-propan-2-one, unii-9y07g5udkq, fema no. 2397 | |
| YFKBXYGUSOXJGS-UHFFFAOYSA-N | |
| 1,3-diphenylpropan-2-one | |
| 7593 | |
| 99% | |
| 1, 3-Diphenylacetone |
| 98.5 | |
| 30.0°C to 34.0°C | |
| 1.0400g/mL | |
| >110°C | |
| 98.5% min. (GC) | |
| C15H14O | |
| MFCD00004795 | |
| 07,445 | |
| 1.04 | |
| Solubility in water: insoluble. Other solubilities: soluble ethanol, diethyl ether, petroleum ether | |
| O=C(CC1=CC=CC=C1)CC1=CC=CC=C1 | |
| 210.28 | |
| 210.27 | |
| Crystalline Mass or Liquid |
Safety and Handling
EINECSNumber : 203-000-
RUO – Research Use Only